Mercurial > repos > kls286 > chap_test_20230328
comparison build/bdist.linux-x86_64/egg/CHAP/processor.py @ 0:cbbe42422d56 draft
planemo upload for repository https://github.com/CHESSComputing/ChessAnalysisPipeline/tree/galaxy commit 1401a7e1ae007a6bda260d147f9b879e789b73e0-dirty
author | kls286 |
---|---|
date | Tue, 28 Mar 2023 15:07:30 +0000 |
parents | |
children |
comparison
equal
deleted
inserted
replaced
-1:000000000000 | 0:cbbe42422d56 |
---|---|
1 #!/usr/bin/env python | |
2 #-*- coding: utf-8 -*- | |
3 #pylint: disable= | |
4 """ | |
5 File : processor.py | |
6 Author : Valentin Kuznetsov <vkuznet AT gmail dot com> | |
7 Description: Processor module | |
8 """ | |
9 | |
10 # system modules | |
11 import argparse | |
12 import json | |
13 import logging | |
14 import sys | |
15 from time import time | |
16 | |
17 # local modules | |
18 # from pipeline import PipelineObject | |
19 | |
20 class Processor(): | |
21 """ | |
22 Processor represent generic processor | |
23 """ | |
24 def __init__(self): | |
25 """ | |
26 Processor constructor | |
27 """ | |
28 self.__name__ = self.__class__.__name__ | |
29 self.logger = logging.getLogger(self.__name__) | |
30 self.logger.propagate = False | |
31 | |
32 def process(self, data): | |
33 """ | |
34 process data API | |
35 """ | |
36 | |
37 t0 = time() | |
38 self.logger.info(f'Executing "process" with type(data)={type(data)}') | |
39 | |
40 data = self._process(data) | |
41 | |
42 self.logger.info(f'Finished "process" in {time()-t0:.3f} seconds\n') | |
43 | |
44 return(data) | |
45 | |
46 def _process(self, data): | |
47 # If needed, extract data from a returned value of Reader.read | |
48 if isinstance(data, list): | |
49 if all([isinstance(d,dict) for d in data]): | |
50 data = data[0]['data'] | |
51 # process operation is a simple print function | |
52 data += "process part\n" | |
53 # and we return data back to pipeline | |
54 return data | |
55 | |
56 | |
57 class TFaaSImageProcessor(Processor): | |
58 ''' | |
59 A Processor to get predictions from TFaaS inference server. | |
60 ''' | |
61 def process(self, data, url, model, verbose=False): | |
62 """ | |
63 process data API | |
64 """ | |
65 | |
66 t0 = time() | |
67 self.logger.info(f'Executing "process" with url {url} model {model}') | |
68 | |
69 data = self._process(data, url, model, verbose) | |
70 | |
71 self.logger.info(f'Finished "process" in {time()-t0:.3f} seconds\n') | |
72 | |
73 return(data) | |
74 | |
75 def _process(self, data, url, model, verbose): | |
76 '''Print and return the input data. | |
77 | |
78 :param data: Input image data, either file name or actual image data | |
79 :type data: object | |
80 :return: `data` | |
81 :rtype: object | |
82 ''' | |
83 from MLaaS.tfaas_client import predictImage | |
84 from pathlib import Path | |
85 self.logger.info(f"input data {type(data)}") | |
86 if isinstance(data, str) and Path(data).is_file(): | |
87 imgFile = data | |
88 data = predictImage(url, imgFile, model, verbose) | |
89 else: | |
90 rdict = data[0] | |
91 import requests | |
92 img = rdict['data'] | |
93 session = requests.Session() | |
94 rurl = url + '/predict/image' | |
95 payload = dict(model=model) | |
96 files = dict(image=img) | |
97 self.logger.info(f"HTTP request {rurl} with image file and {payload} payload") | |
98 req = session.post(rurl, files=files, data=payload ) | |
99 data = req.content | |
100 data = data.decode("utf-8").replace('\n', '') | |
101 self.logger.info(f"HTTP response {data}") | |
102 | |
103 return(data) | |
104 | |
105 class URLResponseProcessor(Processor): | |
106 def _process(self, data): | |
107 '''Take data returned from URLReader.read and return a decoded version of | |
108 the content. | |
109 | |
110 :param data: input data (output of URLReader.read) | |
111 :type data: list[dict] | |
112 :return: decoded data contents | |
113 :rtype: object | |
114 ''' | |
115 | |
116 data = data[0] | |
117 | |
118 content = data['data'] | |
119 encoding = data['encoding'] | |
120 | |
121 self.logger.debug(f'Decoding content of type {type(content)} with {encoding}') | |
122 | |
123 try: | |
124 content = content.decode(encoding) | |
125 except: | |
126 self.logger.warning(f'Failed to decode content of type {type(content)} with {encoding}') | |
127 | |
128 return(content) | |
129 | |
130 class PrintProcessor(Processor): | |
131 '''A Processor to simply print the input data to stdout and return the | |
132 original input data, unchanged in any way. | |
133 ''' | |
134 | |
135 def _process(self, data): | |
136 '''Print and return the input data. | |
137 | |
138 :param data: Input data | |
139 :type data: object | |
140 :return: `data` | |
141 :rtype: object | |
142 ''' | |
143 | |
144 print(f'{self.__name__} data :') | |
145 | |
146 if callable(getattr(data, '_str_tree', None)): | |
147 # If data is likely an NXobject, print its tree representation | |
148 # (since NXobjects' str representations are just their nxname -- not | |
149 # very helpful). | |
150 print(data._str_tree(attrs=True, recursive=True)) | |
151 else: | |
152 print(str(data)) | |
153 | |
154 return(data) | |
155 | |
156 class NexusToNumpyProcessor(Processor): | |
157 '''A class to convert the default plottable data in an `NXobject` into an | |
158 `numpy.ndarray`. | |
159 ''' | |
160 | |
161 def _process(self, data): | |
162 '''Return the default plottable data signal in `data` as an | |
163 `numpy.ndarray`. | |
164 | |
165 :param data: input NeXus structure | |
166 :type data: nexusformat.nexus.tree.NXobject | |
167 :raises ValueError: if `data` has no default plottable data signal | |
168 :return: default plottable data signal in `data` | |
169 :rtype: numpy.ndarray | |
170 ''' | |
171 | |
172 default_data = data.plottable_data | |
173 | |
174 if default_data is None: | |
175 default_data_path = data.attrs['default'] | |
176 default_data = data.get(default_data_path) | |
177 if default_data is None: | |
178 raise(ValueError(f'The structure of {data} contains no default data')) | |
179 | |
180 default_signal = default_data.attrs.get('signal') | |
181 if default_signal is None: | |
182 raise(ValueError(f'The signal of {default_data} is unknown')) | |
183 default_signal = default_signal.nxdata | |
184 | |
185 np_data = default_data[default_signal].nxdata | |
186 | |
187 return(np_data) | |
188 | |
189 class NexusToXarrayProcessor(Processor): | |
190 '''A class to convert the default plottable data in an `NXobject` into an | |
191 `xarray.DataArray`.''' | |
192 | |
193 def _process(self, data): | |
194 '''Return the default plottable data signal in `data` as an | |
195 `xarray.DataArray`. | |
196 | |
197 :param data: input NeXus structure | |
198 :type data: nexusformat.nexus.tree.NXobject | |
199 :raises ValueError: if metadata for `xarray` is absen from `data` | |
200 :return: default plottable data signal in `data` | |
201 :rtype: xarray.DataArray | |
202 ''' | |
203 | |
204 from xarray import DataArray | |
205 | |
206 default_data = data.plottable_data | |
207 | |
208 if default_data is None: | |
209 default_data_path = data.attrs['default'] | |
210 default_data = data.get(default_data_path) | |
211 if default_data is None: | |
212 raise(ValueError(f'The structure of {data} contains no default data')) | |
213 | |
214 default_signal = default_data.attrs.get('signal') | |
215 if default_signal is None: | |
216 raise(ValueError(f'The signal of {default_data} is unknown')) | |
217 default_signal = default_signal.nxdata | |
218 | |
219 signal_data = default_data[default_signal].nxdata | |
220 | |
221 axes = default_data.attrs['axes'] | |
222 coords = {} | |
223 for axis_name in axes: | |
224 axis = default_data[axis_name] | |
225 coords[axis_name] = (axis_name, | |
226 axis.nxdata, | |
227 axis.attrs) | |
228 | |
229 dims = tuple(axes) | |
230 | |
231 name = default_signal | |
232 | |
233 attrs = default_data[default_signal].attrs | |
234 | |
235 return(DataArray(data=signal_data, | |
236 coords=coords, | |
237 dims=dims, | |
238 name=name, | |
239 attrs=attrs)) | |
240 | |
241 class XarrayToNexusProcessor(Processor): | |
242 '''A class to convert the data in an `xarray` structure to an | |
243 `nexusformat.nexus.NXdata`. | |
244 ''' | |
245 | |
246 def _process(self, data): | |
247 '''Return `data` represented as an `nexusformat.nexus.NXdata`. | |
248 | |
249 :param data: The input `xarray` structure | |
250 :type data: typing.Union[xarray.DataArray, xarray.Dataset] | |
251 :return: The data and metadata in `data` | |
252 :rtype: nexusformat.nexus.NXdata | |
253 ''' | |
254 | |
255 from nexusformat.nexus import NXdata, NXfield | |
256 | |
257 signal = NXfield(value=data.data, name=data.name, attrs=data.attrs) | |
258 | |
259 axes = [] | |
260 for name, coord in data.coords.items(): | |
261 axes.append(NXfield(value=coord.data, name=name, attrs=coord.attrs)) | |
262 axes = tuple(axes) | |
263 | |
264 return(NXdata(signal=signal, axes=axes)) | |
265 | |
266 class XarrayToNumpyProcessor(Processor): | |
267 '''A class to convert the data in an `xarray.DataArray` structure to an | |
268 `numpy.ndarray`. | |
269 ''' | |
270 | |
271 def _process(self, data): | |
272 '''Return just the signal values contained in `data`. | |
273 | |
274 :param data: The input `xarray.DataArray` | |
275 :type data: xarray.DataArray | |
276 :return: The data in `data` | |
277 :rtype: numpy.ndarray | |
278 ''' | |
279 | |
280 return(data.data) | |
281 | |
282 class MapProcessor(Processor): | |
283 '''Class representing a process that takes a map configuration and returns a | |
284 `nexusformat.nexus.NXentry` representing that map's metadata and any | |
285 scalar-valued raw data requseted by the supplied map configuration. | |
286 ''' | |
287 | |
288 def _process(self, data): | |
289 '''Process the output of a `Reader` that contains a map configuration and | |
290 return a `nexusformat.nexus.NXentry` representing the map. | |
291 | |
292 :param data: Result of `Reader.read` where at least one item has the | |
293 value `'MapConfig'` for the `'schema'` key. | |
294 :type data: list[dict[str,object]] | |
295 :return: Map data & metadata (SPEC only, no detector) | |
296 :rtype: nexusformat.nexus.NXentry | |
297 ''' | |
298 | |
299 map_config = self.get_map_config(data) | |
300 nxentry = self.__class__.get_nxentry(map_config) | |
301 | |
302 return(nxentry) | |
303 | |
304 def get_map_config(self, data): | |
305 '''Get an instance of `MapConfig` from a returned value of `Reader.read` | |
306 | |
307 :param data: Result of `Reader.read` where at least one item has the | |
308 value `'MapConfig'` for the `'schema'` key. | |
309 :type data: list[dict[str,object]] | |
310 :raises Exception: If a valid `MapConfig` cannot be constructed from `data`. | |
311 :return: a valid instance of `MapConfig` with field values taken from `data`. | |
312 :rtype: MapConfig | |
313 ''' | |
314 | |
315 from CHAP.models.map import MapConfig | |
316 | |
317 map_config = False | |
318 if isinstance(data, list): | |
319 for item in data: | |
320 if isinstance(item, dict): | |
321 if item.get('schema') == 'MapConfig': | |
322 map_config = item.get('data') | |
323 break | |
324 | |
325 if not map_config: | |
326 raise(ValueError('No map configuration found')) | |
327 | |
328 return(MapConfig(**map_config)) | |
329 | |
330 @staticmethod | |
331 def get_nxentry(map_config): | |
332 '''Use a `MapConfig` to construct a `nexusformat.nexus.NXentry` | |
333 | |
334 :param map_config: a valid map configuration | |
335 :type map_config: MapConfig | |
336 :return: the map's data and metadata contained in a NeXus structure | |
337 :rtype: nexusformat.nexus.NXentry | |
338 ''' | |
339 | |
340 from nexusformat.nexus import (NXcollection, | |
341 NXdata, | |
342 NXentry, | |
343 NXfield, | |
344 NXsample) | |
345 import numpy as np | |
346 | |
347 nxentry = NXentry(name=map_config.title) | |
348 | |
349 nxentry.map_config = json.dumps(map_config.dict()) | |
350 | |
351 nxentry[map_config.sample.name] = NXsample(**map_config.sample.dict()) | |
352 | |
353 nxentry.attrs['station'] = map_config.station | |
354 | |
355 nxentry.spec_scans = NXcollection() | |
356 for scans in map_config.spec_scans: | |
357 nxentry.spec_scans[scans.scanparsers[0].scan_name] = \ | |
358 NXfield(value=scans.scan_numbers, | |
359 dtype='int8', | |
360 attrs={'spec_file':str(scans.spec_file)}) | |
361 | |
362 nxentry.data = NXdata() | |
363 nxentry.data.attrs['axes'] = map_config.dims | |
364 for i,dim in enumerate(map_config.independent_dimensions[::-1]): | |
365 nxentry.data[dim.label] = NXfield(value=map_config.coords[dim.label], | |
366 units=dim.units, | |
367 attrs={'long_name': f'{dim.label} ({dim.units})', | |
368 'data_type': dim.data_type, | |
369 'local_name': dim.name}) | |
370 nxentry.data.attrs[f'{dim.label}_indices'] = i | |
371 | |
372 signal = False | |
373 auxilliary_signals = [] | |
374 for data in map_config.all_scalar_data: | |
375 nxentry.data[data.label] = NXfield(value=np.empty(map_config.shape), | |
376 units=data.units, | |
377 attrs={'long_name': f'{data.label} ({data.units})', | |
378 'data_type': data.data_type, | |
379 'local_name': data.name}) | |
380 if not signal: | |
381 signal = data.label | |
382 else: | |
383 auxilliary_signals.append(data.label) | |
384 | |
385 if signal: | |
386 nxentry.data.attrs['signal'] = signal | |
387 nxentry.data.attrs['auxilliary_signals'] = auxilliary_signals | |
388 | |
389 for scans in map_config.spec_scans: | |
390 for scan_number in scans.scan_numbers: | |
391 scanparser = scans.get_scanparser(scan_number) | |
392 for scan_step_index in range(scanparser.spec_scan_npts): | |
393 map_index = scans.get_index(scan_number, scan_step_index, map_config) | |
394 for data in map_config.all_scalar_data: | |
395 nxentry.data[data.label][map_index] = data.get_value(scans, scan_number, scan_step_index) | |
396 | |
397 return(nxentry) | |
398 | |
399 class IntegrationProcessor(Processor): | |
400 '''Class for integrating 2D detector data | |
401 ''' | |
402 | |
403 def _process(self, data): | |
404 '''Integrate the input data with the integration method and keyword | |
405 arguments supplied and return the results. | |
406 | |
407 :param data: input data, including raw data, integration method, and | |
408 keyword args for the integration method. | |
409 :type data: tuple[typing.Union[numpy.ndarray, list[numpy.ndarray]], | |
410 callable, | |
411 dict] | |
412 :param integration_method: the method of a | |
413 `pyFAI.azimuthalIntegrator.AzimuthalIntegrator` or | |
414 `pyFAI.multi_geometry.MultiGeometry` that returns the desired | |
415 integration results. | |
416 :return: integrated raw data | |
417 :rtype: pyFAI.containers.IntegrateResult | |
418 ''' | |
419 | |
420 detector_data, integration_method, integration_kwargs = data | |
421 | |
422 return(integration_method(detector_data, **integration_kwargs)) | |
423 | |
424 class IntegrateMapProcessor(Processor): | |
425 '''Class representing a process that takes a map and integration | |
426 configuration and returns a `nexusformat.nexus.NXprocess` containing a map of | |
427 the integrated detector data requested. | |
428 ''' | |
429 | |
430 def _process(self, data): | |
431 '''Process the output of a `Reader` that contains a map and integration | |
432 configuration and return a `nexusformat.nexus.NXprocess` containing a map | |
433 of the integrated detector data requested | |
434 | |
435 :param data: Result of `Reader.read` where at least one item has the | |
436 value `'MapConfig'` for the `'schema'` key, and at least one item has | |
437 the value `'IntegrationConfig'` for the `'schema'` key. | |
438 :type data: list[dict[str,object]] | |
439 :return: integrated data and process metadata | |
440 :rtype: nexusformat.nexus.NXprocess | |
441 ''' | |
442 | |
443 map_config, integration_config = self.get_configs(data) | |
444 nxprocess = self.get_nxprocess(map_config, integration_config) | |
445 | |
446 return(nxprocess) | |
447 | |
448 def get_configs(self, data): | |
449 '''Return valid instances of `MapConfig` and `IntegrationConfig` from the | |
450 input supplied by `MultipleReader`. | |
451 | |
452 :param data: Result of `Reader.read` where at least one item has the | |
453 value `'MapConfig'` for the `'schema'` key, and at least one item has | |
454 the value `'IntegrationConfig'` for the `'schema'` key. | |
455 :type data: list[dict[str,object]] | |
456 :raises ValueError: if `data` cannot be parsed into map and integration configurations. | |
457 :return: valid map and integration configuration objects. | |
458 :rtype: tuple[MapConfig, IntegrationConfig] | |
459 ''' | |
460 | |
461 self.logger.debug('Getting configuration objects') | |
462 t0 = time() | |
463 | |
464 from CHAP.models.map import MapConfig | |
465 from CHAP.models.integration import IntegrationConfig | |
466 | |
467 map_config = False | |
468 integration_config = False | |
469 if isinstance(data, list): | |
470 for item in data: | |
471 if isinstance(item, dict): | |
472 schema = item.get('schema') | |
473 if schema == 'MapConfig': | |
474 map_config = item.get('data') | |
475 elif schema == 'IntegrationConfig': | |
476 integration_config = item.get('data') | |
477 | |
478 if not map_config: | |
479 raise(ValueError('No map configuration found')) | |
480 if not integration_config: | |
481 raise(ValueError('No integration configuration found')) | |
482 | |
483 map_config = MapConfig(**map_config) | |
484 integration_config = IntegrationConfig(**integration_config) | |
485 | |
486 self.logger.debug(f'Got configuration objects in {time()-t0:.3f} seconds') | |
487 | |
488 return(map_config, integration_config) | |
489 | |
490 def get_nxprocess(self, map_config, integration_config): | |
491 '''Use a `MapConfig` and `IntegrationConfig` to construct a | |
492 `nexusformat.nexus.NXprocess` | |
493 | |
494 :param map_config: a valid map configuration | |
495 :type map_config: MapConfig | |
496 :param integration_config: a valid integration configuration | |
497 :type integration_config" IntegrationConfig | |
498 :return: the integrated detector data and metadata contained in a NeXus | |
499 structure | |
500 :rtype: nexusformat.nexus.NXprocess | |
501 ''' | |
502 | |
503 self.logger.debug('Constructing NXprocess') | |
504 t0 = time() | |
505 | |
506 from nexusformat.nexus import (NXdata, | |
507 NXdetector, | |
508 NXfield, | |
509 NXprocess) | |
510 import numpy as np | |
511 import pyFAI | |
512 | |
513 nxprocess = NXprocess(name=integration_config.title) | |
514 | |
515 nxprocess.map_config = json.dumps(map_config.dict()) | |
516 nxprocess.integration_config = json.dumps(integration_config.dict()) | |
517 | |
518 nxprocess.program = 'pyFAI' | |
519 nxprocess.version = pyFAI.version | |
520 | |
521 for k,v in integration_config.dict().items(): | |
522 if k == 'detectors': | |
523 continue | |
524 nxprocess.attrs[k] = v | |
525 | |
526 for detector in integration_config.detectors: | |
527 nxprocess[detector.prefix] = NXdetector() | |
528 nxprocess[detector.prefix].local_name = detector.prefix | |
529 nxprocess[detector.prefix].distance = detector.azimuthal_integrator.dist | |
530 nxprocess[detector.prefix].distance.attrs['units'] = 'm' | |
531 nxprocess[detector.prefix].calibration_wavelength = detector.azimuthal_integrator.wavelength | |
532 nxprocess[detector.prefix].calibration_wavelength.attrs['units'] = 'm' | |
533 nxprocess[detector.prefix].attrs['poni_file'] = str(detector.poni_file) | |
534 nxprocess[detector.prefix].attrs['mask_file'] = str(detector.mask_file) | |
535 nxprocess[detector.prefix].raw_data_files = np.full(map_config.shape, '', dtype='|S256') | |
536 | |
537 nxprocess.data = NXdata() | |
538 | |
539 nxprocess.data.attrs['axes'] = (*map_config.dims, *integration_config.integrated_data_dims) | |
540 for i,dim in enumerate(map_config.independent_dimensions[::-1]): | |
541 nxprocess.data[dim.label] = NXfield(value=map_config.coords[dim.label], | |
542 units=dim.units, | |
543 attrs={'long_name': f'{dim.label} ({dim.units})', | |
544 'data_type': dim.data_type, | |
545 'local_name': dim.name}) | |
546 nxprocess.data.attrs[f'{dim.label}_indices'] = i | |
547 | |
548 for i,(coord_name,coord_values) in enumerate(integration_config.integrated_data_coordinates.items()): | |
549 if coord_name == 'radial': | |
550 type_ = pyFAI.units.RADIAL_UNITS | |
551 elif coord_name == 'azimuthal': | |
552 type_ = pyFAI.units.AZIMUTHAL_UNITS | |
553 coord_units = pyFAI.units.to_unit(getattr(integration_config, f'{coord_name}_units'), type_=type_) | |
554 nxprocess.data[coord_units.name] = coord_values | |
555 nxprocess.data.attrs[f'{coord_units.name}_indices'] = i+len(map_config.coords) | |
556 nxprocess.data[coord_units.name].units = coord_units.unit_symbol | |
557 nxprocess.data[coord_units.name].attrs['long_name'] = coord_units.label | |
558 | |
559 nxprocess.data.attrs['signal'] = 'I' | |
560 nxprocess.data.I = NXfield(value=np.empty((*tuple([len(coord_values) for coord_name,coord_values in map_config.coords.items()][::-1]), *integration_config.integrated_data_shape)), | |
561 units='a.u', | |
562 attrs={'long_name':'Intensity (a.u)'}) | |
563 | |
564 integrator = integration_config.get_multi_geometry_integrator() | |
565 if integration_config.integration_type == 'azimuthal': | |
566 integration_method = integrator.integrate1d | |
567 integration_kwargs = { | |
568 'lst_mask': [detector.mask_array for detector in integration_config.detectors], | |
569 'npt': integration_config.radial_npt | |
570 } | |
571 elif integration_config.integration_type == 'cake': | |
572 integration_method = integrator.integrate2d | |
573 integration_kwargs = { | |
574 'lst_mask': [detector.mask_array for detector in integration_config.detectors], | |
575 'npt_rad': integration_config.radial_npt, | |
576 'npt_azim': integration_config.azimuthal_npt, | |
577 'method': 'bbox' | |
578 } | |
579 | |
580 integration_processor = IntegrationProcessor() | |
581 integration_processor.logger.setLevel(self.logger.getEffectiveLevel()) | |
582 integration_processor.logger.addHandler(self.logger.handlers[0]) | |
583 lst_args = [] | |
584 for scans in map_config.spec_scans: | |
585 for scan_number in scans.scan_numbers: | |
586 scanparser = scans.get_scanparser(scan_number) | |
587 for scan_step_index in range(scanparser.spec_scan_npts): | |
588 map_index = scans.get_index(scan_number, scan_step_index, map_config) | |
589 detector_data = scans.get_detector_data(integration_config.detectors, scan_number, scan_step_index) | |
590 result = integration_processor.process((detector_data, integration_method, integration_kwargs)) | |
591 nxprocess.data.I[map_index] = result.intensity | |
592 for detector in integration_config.detectors: | |
593 nxprocess[detector.prefix].raw_data_files[map_index] = scanparser.get_detector_data_file(detector.prefix, scan_step_index) | |
594 | |
595 self.logger.debug(f'Constructed NXprocess in {time()-t0:.3f} seconds') | |
596 | |
597 return(nxprocess) | |
598 | |
599 class MCACeriaCalibrationProcessor(Processor): | |
600 '''Class representing the procedure to use a CeO2 scan to obtain tuned values | |
601 for the bragg diffraction angle and linear correction parameters for MCA | |
602 channel energies for an EDD experimental setup. | |
603 ''' | |
604 | |
605 def _process(self, data): | |
606 '''Return tuned values for 2&theta and linear correction parameters for | |
607 the MCA channel energies. | |
608 | |
609 :param data: input configuration for the raw data & tuning procedure | |
610 :type data: list[dict[str,object]] | |
611 :return: original configuration dictionary with tuned values added | |
612 :rtype: dict[str,float] | |
613 ''' | |
614 | |
615 calibration_config = self.get_config(data) | |
616 | |
617 tth, slope, intercept = self.calibrate(calibration_config) | |
618 | |
619 calibration_config.tth_calibrated = tth | |
620 calibration_config.slope_calibrated = slope | |
621 calibration_config.intercept_calibrated = intercept | |
622 | |
623 return(calibration_config.dict()) | |
624 | |
625 def get_config(self, data): | |
626 '''Get an instance of the configuration object needed by this | |
627 `Processor` from a returned value of `Reader.read` | |
628 | |
629 :param data: Result of `Reader.read` where at least one item has the | |
630 value `'MCACeriaCalibrationConfig'` for the `'schema'` key. | |
631 :type data: list[dict[str,object]] | |
632 :raises Exception: If a valid config object cannot be constructed from `data`. | |
633 :return: a valid instance of a configuration object with field values | |
634 taken from `data`. | |
635 :rtype: MCACeriaCalibrationConfig | |
636 ''' | |
637 | |
638 from CHAP.models.edd import MCACeriaCalibrationConfig | |
639 | |
640 calibration_config = False | |
641 if isinstance(data, list): | |
642 for item in data: | |
643 if isinstance(item, dict): | |
644 if item.get('schema') == 'MCACeriaCalibrationConfig': | |
645 calibration_config = item.get('data') | |
646 break | |
647 | |
648 if not calibration_config: | |
649 raise(ValueError('No MCA ceria calibration configuration found in input data')) | |
650 | |
651 return(MCACeriaCalibrationConfig(**calibration_config)) | |
652 | |
653 def calibrate(self, calibration_config): | |
654 '''Iteratively calibrate 2&theta by fitting selected peaks of an MCA | |
655 spectrum until the computed strain is sufficiently small. Use the fitted | |
656 peak locations to determine linear correction parameters for the MCA's | |
657 channel energies. | |
658 | |
659 :param calibration_config: object configuring the CeO2 calibration procedure | |
660 :type calibration_config: MCACeriaCalibrationConfig | |
661 :return: calibrated values of 2&theta and linear correction parameters | |
662 for MCA channel energies : tth, slope, intercept | |
663 :rtype: float, float, float | |
664 ''' | |
665 | |
666 from msnctools.fit import Fit, FitMultipeak | |
667 import numpy as np | |
668 from scipy.constants import physical_constants | |
669 | |
670 hc = physical_constants['Planck constant in eV/Hz'][0] * \ | |
671 physical_constants['speed of light in vacuum'][0] * \ | |
672 1e7 # We'll work in keV and A, not eV and m. | |
673 | |
674 # Collect raw MCA data of interest | |
675 mca_data = calibration_config.mca_data() | |
676 mca_bin_energies = np.arange(0, calibration_config.num_bins) * \ | |
677 (calibration_config.max_energy_kev / calibration_config.num_bins) | |
678 | |
679 # Mask out the corrected MCA data for fitting | |
680 mca_mask = calibration_config.mca_mask() | |
681 fit_mca_energies = mca_bin_energies[mca_mask] | |
682 fit_mca_intensities = mca_data[mca_mask] | |
683 | |
684 # Correct raw MCA data for variable flux at different energies | |
685 flux_correct = calibration_config.flux_correction_interpolation_function() | |
686 mca_intensity_weights = flux_correct(fit_mca_energies) | |
687 fit_mca_intensities = fit_mca_intensities / mca_intensity_weights | |
688 | |
689 # Get the HKLs and lattice spacings that will be used for fitting | |
690 tth = calibration_config.tth_initial_guess | |
691 fit_hkls, fit_ds = calibration_config.fit_ds() | |
692 c_1 = fit_hkls[:,0]**2 + fit_hkls[:,1]**2 + fit_hkls[:,2]**2 | |
693 | |
694 for iter_i in range(calibration_config.max_iter): | |
695 | |
696 ### Perform the uniform fit first ### | |
697 | |
698 # Get expected peak energy locations for this iteration's starting | |
699 # value of tth | |
700 fit_lambda = 2.0 * fit_ds * np.sin(0.5*np.radians(tth)) | |
701 fit_E0 = hc / fit_lambda | |
702 | |
703 # Run the uniform fit | |
704 best_fit, residual, best_values, best_errors, redchi, success = \ | |
705 FitMultipeak.fit_multipeak(fit_mca_intensities, | |
706 fit_E0, | |
707 x=fit_mca_energies, | |
708 fit_type='uniform') | |
709 | |
710 # Extract values of interest from the best values for the uniform fit | |
711 # parameters | |
712 uniform_fit_centers = [best_values[f'peak{i+1}_center'] for i in range(len(calibration_config.fit_hkls))] | |
713 # uniform_a = best_values['scale_factor'] | |
714 # uniform_strain = np.log(uniform_a / calibration_config.lattice_parameter_angstrom) | |
715 # uniform_tth = tth * (1.0 + uniform_strain) | |
716 # uniform_rel_rms_error = np.linalg.norm(residual) / np.linalg.norm(fit_mca_intensities) | |
717 | |
718 ### Next, perform the unconstrained fit ### | |
719 | |
720 # Use the peak locations found in the uniform fit as the initial | |
721 # guesses for peak locations in the unconstrained fit | |
722 best_fit, residual, best_values, best_errors, redchi, success = \ | |
723 FitMultipeak.fit_multipeak(fit_mca_intensities, | |
724 uniform_fit_centers, | |
725 x=fit_mca_energies, | |
726 fit_type='unconstrained') | |
727 | |
728 # Extract values of interest from the best values for the | |
729 # unconstrained fit parameters | |
730 unconstrained_fit_centers = np.array([best_values[f'peak{i+1}_center'] for i in range(len(calibration_config.fit_hkls))]) | |
731 unconstrained_a = 0.5 * hc * np.sqrt(c_1) / (unconstrained_fit_centers * abs(np.sin(0.5*np.radians(tth)))) | |
732 unconstrained_strains = np.log(unconstrained_a / calibration_config.lattice_parameter_angstrom) | |
733 unconstrained_strain = np.mean(unconstrained_strains) | |
734 unconstrained_tth = tth * (1.0 + unconstrained_strain) | |
735 # unconstrained_rel_rms_error = np.linalg.norm(residual) / np.linalg.norm(fit_mca_intensities) | |
736 | |
737 | |
738 # Update tth for the next iteration of tuning | |
739 prev_tth = tth | |
740 tth = unconstrained_tth | |
741 | |
742 # Stop tuning tth at this iteration if differences are small enough | |
743 if abs(tth - prev_tth) < calibration_config.tune_tth_tol: | |
744 break | |
745 | |
746 # Fit line to expected / computed peak locations from the last | |
747 # unconstrained fit. | |
748 fit = Fit.fit_data(fit_E0,'linear', x=unconstrained_fit_centers, nan_policy='omit') | |
749 slope = fit.best_values['slope'] | |
750 intercept = fit.best_values['intercept'] | |
751 | |
752 return(float(tth), float(slope), float(intercept)) | |
753 | |
754 class MCADataProcessor(Processor): | |
755 '''Class representing a process to return data from a MCA, restuctured to | |
756 incorporate the shape & metadata associated with a map configuration to | |
757 which the MCA data belongs, and linearly transformed according to the | |
758 results of a ceria calibration. | |
759 ''' | |
760 | |
761 def _process(self, data): | |
762 '''Process configurations for a map and MCA detector(s), and return the | |
763 raw MCA data collected over the map. | |
764 | |
765 :param data: input map configuration and results of ceria calibration | |
766 :type data: list[dict[str,object]] | |
767 :return: calibrated and flux-corrected MCA data | |
768 :rtype: nexusformat.nexus.NXentry | |
769 ''' | |
770 | |
771 map_config, calibration_config = self.get_configs(data) | |
772 nxroot = self.get_nxroot(map_config, calibration_config) | |
773 | |
774 return(nxroot) | |
775 | |
776 def get_configs(self, data): | |
777 '''Get instances of the configuration objects needed by this | |
778 `Processor` from a returned value of `Reader.read` | |
779 | |
780 :param data: Result of `Reader.read` where at least one item has the | |
781 value `'MapConfig'` for the `'schema'` key, and at least one item has | |
782 the value `'MCACeriaCalibrationConfig'` for the `'schema'` key. | |
783 :type data: list[dict[str,object]] | |
784 :raises Exception: If valid config objects cannot be constructed from `data`. | |
785 :return: valid instances of the configuration objects with field values | |
786 taken from `data`. | |
787 :rtype: tuple[MapConfig, MCACeriaCalibrationConfig] | |
788 ''' | |
789 | |
790 from CHAP.models.map import MapConfig | |
791 from CHAP.models.edd import MCACeriaCalibrationConfig | |
792 | |
793 map_config = False | |
794 calibration_config = False | |
795 if isinstance(data, list): | |
796 for item in data: | |
797 if isinstance(item, dict): | |
798 schema = item.get('schema') | |
799 if schema == 'MapConfig': | |
800 map_config = item.get('data') | |
801 elif schema == 'MCACeriaCalibrationConfig': | |
802 calibration_config = item.get('data') | |
803 | |
804 if not map_config: | |
805 raise(ValueError('No map configuration found in input data')) | |
806 if not calibration_config: | |
807 raise(ValueError('No MCA ceria calibration configuration found in input data')) | |
808 | |
809 return(MapConfig(**map_config), MCACeriaCalibrationConfig(**calibration_config)) | |
810 | |
811 def get_nxroot(self, map_config, calibration_config): | |
812 '''Get a map of the MCA data collected by the scans in `map_config`. The | |
813 MCA data will be calibrated and flux-corrected according to the | |
814 parameters included in `calibration_config`. The data will be returned | |
815 along with relevant metadata in the form of a NeXus structure. | |
816 | |
817 :param map_config: the map configuration | |
818 :type map_config: MapConfig | |
819 :param calibration_config: the calibration configuration | |
820 :type calibration_config: MCACeriaCalibrationConfig | |
821 :return: a map of the calibrated and flux-corrected MCA data | |
822 :rtype: nexusformat.nexus.NXroot | |
823 ''' | |
824 | |
825 from nexusformat.nexus import (NXdata, | |
826 NXdetector, | |
827 NXentry, | |
828 NXinstrument, | |
829 NXroot) | |
830 import numpy as np | |
831 | |
832 nxroot = NXroot() | |
833 | |
834 nxroot[map_config.title] = MapProcessor.get_nxentry(map_config) | |
835 nxentry = nxroot[map_config.title] | |
836 | |
837 nxentry.instrument = NXinstrument() | |
838 nxentry.instrument.detector = NXdetector() | |
839 nxentry.instrument.detector.calibration_configuration = json.dumps(calibration_config.dict()) | |
840 | |
841 nxentry.instrument.detector.data = NXdata() | |
842 nxdata = nxentry.instrument.detector.data | |
843 nxdata.raw = np.empty((*map_config.shape, calibration_config.num_bins)) | |
844 nxdata.raw.attrs['units'] = 'counts' | |
845 nxdata.channel_energy = calibration_config.slope_calibrated * \ | |
846 np.arange(0, calibration_config.num_bins) * \ | |
847 (calibration_config.max_energy_kev / calibration_config.num_bins) + \ | |
848 calibration_config.intercept_calibrated | |
849 nxdata.channel_energy.attrs['units'] = 'keV' | |
850 | |
851 for scans in map_config.spec_scans: | |
852 for scan_number in scans.scan_numbers: | |
853 scanparser = scans.get_scanparser(scan_number) | |
854 for scan_step_index in range(scanparser.spec_scan_npts): | |
855 map_index = scans.get_index(scan_number, scan_step_index, map_config) | |
856 nxdata.raw[map_index] = scanparser.get_detector_data(calibration_config.detector_name, scan_step_index) | |
857 | |
858 nxentry.data.makelink(nxdata.raw, name=calibration_config.detector_name) | |
859 nxentry.data.makelink(nxdata.channel_energy, name=f'{calibration_config.detector_name}_channel_energy') | |
860 if isinstance(nxentry.data.attrs['axes'], str): | |
861 nxentry.data.attrs['axes'] = [nxentry.data.attrs['axes'], f'{calibration_config.detector_name}_channel_energy'] | |
862 else: | |
863 nxentry.data.attrs['axes'] += [f'{calibration_config.detector_name}_channel_energy'] | |
864 nxentry.data.attrs['signal'] = calibration_config.detector_name | |
865 | |
866 return(nxroot) | |
867 | |
868 class StrainAnalysisProcessor(Processor): | |
869 '''Class representing a process to compute a map of sample strains by fitting | |
870 bragg peaks in 1D detector data and analyzing the difference between measured | |
871 peak locations and expected peak locations for the sample measured. | |
872 ''' | |
873 | |
874 def _process(self, data): | |
875 '''Process the input map detector data & configuration for the strain | |
876 analysis procedure, and return a map of sample strains. | |
877 | |
878 :param data: results of `MutlipleReader.read` containing input map | |
879 detector data and strain analysis configuration | |
880 :type data: dict[list[str,object]] | |
881 :return: map of sample strains | |
882 :rtype: xarray.Dataset | |
883 ''' | |
884 | |
885 strain_analysis_config = self.get_config(data) | |
886 | |
887 return(data) | |
888 | |
889 def get_config(self, data): | |
890 '''Get instances of the configuration objects needed by this | |
891 `Processor` from a returned value of `Reader.read` | |
892 | |
893 :param data: Result of `Reader.read` where at least one item has the | |
894 value `'StrainAnalysisConfig'` for the `'schema'` key. | |
895 :type data: list[dict[str,object]] | |
896 :raises Exception: If valid config objects cannot be constructed from `data`. | |
897 :return: valid instances of the configuration objects with field values | |
898 taken from `data`. | |
899 :rtype: StrainAnalysisConfig | |
900 ''' | |
901 | |
902 strain_analysis_config = False | |
903 if isinstance(data, list): | |
904 for item in data: | |
905 if isinstance(item, dict): | |
906 schema = item.get('schema') | |
907 if item.get('schema') == 'StrainAnalysisConfig': | |
908 strain_analysis_config = item.get('data') | |
909 | |
910 if not strain_analysis_config: | |
911 raise(ValueError('No strain analysis configuration found in input data')) | |
912 | |
913 return(strain_analysis_config) | |
914 | |
915 | |
916 class OptionParser(): | |
917 '''User based option parser''' | |
918 def __init__(self): | |
919 self.parser = argparse.ArgumentParser(prog='PROG') | |
920 self.parser.add_argument("--data", action="store", | |
921 dest="data", default="", help="Input data") | |
922 self.parser.add_argument("--processor", action="store", | |
923 dest="processor", default="Processor", help="Processor class name") | |
924 self.parser.add_argument('--log-level', choices=logging._nameToLevel.keys(), | |
925 dest='log_level', default='INFO', help='logging level') | |
926 | |
927 def main(): | |
928 '''Main function''' | |
929 optmgr = OptionParser() | |
930 opts = optmgr.parser.parse_args() | |
931 clsName = opts.processor | |
932 try: | |
933 processorCls = getattr(sys.modules[__name__],clsName) | |
934 except: | |
935 print(f'Unsupported processor {clsName}') | |
936 sys.exit(1) | |
937 | |
938 processor = processorCls() | |
939 processor.logger.setLevel(getattr(logging, opts.log_level)) | |
940 log_handler = logging.StreamHandler() | |
941 log_handler.setFormatter(logging.Formatter('{name:20}: {message}', style='{')) | |
942 processor.logger.addHandler(log_handler) | |
943 data = processor.process(opts.data) | |
944 | |
945 print(f"Processor {processor} operates on data {data}") | |
946 | |
947 if __name__ == '__main__': | |
948 main() |